Nootropic Pramiracetam
Pramiracetam is a lipid-soluble nootropic of the Racetam chemical family, and has a relatively similar chemical structure compared to its cousin Aniracetam. However, this nootropic is much stronger than Aniracetam. Pramiracetam has the capabilities of increasing the long term memory of individuals, allowing obtained information and knowledge to be recalled more easily. Considering that the high-affinity choline uptake (HACU) is increased implies an increase in the synthesis and release of Acetylcholine. The information shows how this smart drug increases both the Hippocampal Acetylcholine activity and the learning and memory encoding process
Technical Data for Pramiracetam
| M. Wt | 269.38 |
| Formula | C14H27N3O2 |
| Storage | Store at +4°C |
| Purity | ≥99% (HPLC) |
| CAS Number | 68497-62-1 |
| EINECS | 806-175-7 |
| Appearance | Powder Form |
| Smiles | O=C(COC1=CC=C(Cl)C=C1)N[C@@H]2CC[C@@H](NC(COC3=CC=C(Cl)C=C3)=O)CC2 |
What are nootropics ?
Nootropics also referred to as smart drugs, memory enhancers, neuro enhancers, cognitive enhancers, and intelligence enhancers, are drugs, supplements, nutraceuticals, and functional foods that purportedly improve mental functions such as cognition, memory, intelligence, motivation, attention, and concentration.
Function
- Improved Memory
- Increased Learning Ability
- Improved Cognitive Processing
- Heightened Reflexes
- Heightened Perception
- Reduced Anxiety
- Reduced Depression